C13H15Br2NO4S — CID 61216236
methyl 1-(2,4-dibromophenyl)sulfonylpiperidine-2-carboxylate (PubChem CID 61216236) has the molecular formula C13H15Br2NO4S and a molecular weight of 441.14 g/mol. Its IUPAC name is methyl 1-(2,4-dibromophenyl)sulfonylpiperidine-2-carboxylate.
| Compound Name | methyl 1-(2,4-dibromophenyl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 61216236 |
| Molecular Formula | C13H15Br2NO4S |
| Molecular Weight | 441.14 g/mol |
| Exact Mass | 438.91 |
| IUPAC Name | methyl 1-(2,4-dibromophenyl)sulfonylpiperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1S(=O)(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H15Br2NO4S/c1-20-13(17)11-4-2-3-7-16(11)21(18,19)12-6-5-9(14)8-10(12)15/h5-6,8,11H,2-4,7H2,1H3 |
| InChIKey | YQOGKIMROMEGRU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.14 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |