C12H15BrN2O4S — CID 43473909
methyl 1-(4-amino-2-bromophenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 43473909) has the molecular formula C12H15BrN2O4S and a molecular weight of 363.23 g/mol. Its IUPAC name is methyl 1-(4-amino-2-bromophenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(4-amino-2-bromophenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 43473909 |
| Molecular Formula | C12H15BrN2O4S |
| Molecular Weight | 363.23 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | methyl 1-(4-amino-2-bromophenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1S(=O)(=O)c1ccc(N)cc1Br |
| InChI | InChI=1S/C12H15BrN2O4S/c1-19-12(16)10-3-2-6-15(10)20(17,18)11-5-4-8(14)7-9(11)13/h4-5,7,10H,2-3,6,14H2,1H3 |
| InChIKey | JGUPAHDEWIBPQI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|