C13H17BrN2O4S — CID 61115015
methyl 1-(2-amino-5-bromophenyl)sulfonylpiperidine-2-carboxylate (PubChem CID 61115015) has the molecular formula C13H17BrN2O4S and a molecular weight of 377.26 g/mol. Its IUPAC name is methyl 1-(2-amino-5-bromophenyl)sulfonylpiperidine-2-carboxylate.
| Compound Name | methyl 1-(2-amino-5-bromophenyl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 61115015 |
| Molecular Formula | C13H17BrN2O4S |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | methyl 1-(2-amino-5-bromophenyl)sulfonylpiperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1S(=O)(=O)c1cc(Br)ccc1N |
| InChI | InChI=1S/C13H17BrN2O4S/c1-20-13(17)11-4-2-3-7-16(11)21(18,19)12-8-9(14)5-6-10(12)15/h5-6,8,11H,2-4,7,15H2,1H3 |
| InChIKey | YAUDVOIQYCYMMZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|