C18H17FN2O6S — CID 11930030
(4-nitrophenyl)methyl (2S)-1-(2-fluorophenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 11930030) has the molecular formula C18H17FN2O6S and a molecular weight of 408.41 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S)-1-(2-fluorophenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S)-1-(2-fluorophenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 11930030 |
| Molecular Formula | C18H17FN2O6S |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | (4-nitrophenyl)methyl (2S)-1-(2-fluorophenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)[C@@H]1CCCN1S(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C18H17FN2O6S/c19-15-4-1-2-6-17(15)28(25,26)20-11-3-5-16(20)18(22)27-12-13-7-9-14(10-8-13)21(23)24/h1-2,4,6-10,16H,3,5,11-12H2/t16-/m0/s1 |
| InChIKey | RWXBJIRHUZFAKC-INIZCTEOSA-N |
| XLogP | 2.63 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|