C16H16ClNO4S2 — CID 3866320
benzyl 1-(5-chlorothiophen-2-yl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 3866320) has the molecular formula C16H16ClNO4S2 and a molecular weight of 385.89 g/mol. Its IUPAC name is benzyl 1-(5-chlorothiophen-2-yl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | benzyl 1-(5-chlorothiophen-2-yl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 3866320 |
| Molecular Formula | C16H16ClNO4S2 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | benzyl 1-(5-chlorothiophen-2-yl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1CCCN1S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H16ClNO4S2/c17-14-8-9-15(23-14)24(20,21)18-10-4-7-13(18)16(19)22-11-12-5-2-1-3-6-12/h1-3,5-6,8-9,13H,4,7,10-11H2 |
| InChIKey | GBBAAWWGJBEPII-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |