C16H17ClN2O3S2 — CID 51648857
(2S)-1-(5-chlorothiophen-2-yl)sulfonyl-N-methyl-N-phenylpyrrolidine-2-carboxamide (PubChem CID 51648857) has the molecular formula C16H17ClN2O3S2 and a molecular weight of 384.91 g/mol. Its IUPAC name is (2S)-1-(5-chlorothiophen-2-yl)sulfonyl-N-methyl-N-phenylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(5-chlorothiophen-2-yl)sulfonyl-N-methyl-N-phenylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 51648857 |
| Molecular Formula | C16H17ClN2O3S2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | (2S)-1-(5-chlorothiophen-2-yl)sulfonyl-N-methyl-N-phenylpyrrolidine-2-carboxamide |
| SMILES | CN(C(=O)[C@@H]1CCCN1S(=O)(=O)c1ccc(Cl)s1)c1ccccc1 |
| InChI | InChI=1S/C16H17ClN2O3S2/c1-18(12-6-3-2-4-7-12)16(20)13-8-5-11-19(13)24(21,22)15-10-9-14(17)23-15/h2-4,6-7,9-10,13H,5,8,11H2,1H3/t13-/m0/s1 |
| InChIKey | ZCAUHMHMXCMPIU-ZDUSSCGKSA-N |
| XLogP | 3.22 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |