C15H15ClN2O3S2 — CID 7614869
(2S)-1-(5-chlorothiophen-2-yl)sulfonyl-N-phenylpyrrolidine-2-carboxamide (PubChem CID 7614869) has the molecular formula C15H15ClN2O3S2 and a molecular weight of 370.88 g/mol. Its IUPAC name is (2S)-1-(5-chlorothiophen-2-yl)sulfonyl-N-phenylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(5-chlorothiophen-2-yl)sulfonyl-N-phenylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 7614869 |
| Molecular Formula | C15H15ClN2O3S2 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | (2S)-1-(5-chlorothiophen-2-yl)sulfonyl-N-phenylpyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)[C@@H]1CCCN1S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H15ClN2O3S2/c16-13-8-9-14(22-13)23(20,21)18-10-4-7-12(18)15(19)17-11-5-2-1-3-6-11/h1-3,5-6,8-9,12H,4,7,10H2,(H,17,19)/t12-/m0/s1 |
| InChIKey | YRTXENQOBMAKJM-LBPRGKRZSA-N |
| XLogP | 3.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |