C17H14ClN3O5S2 — CID 25303397
(2R)-1-(5-chlorothiophen-2-yl)sulfonyl-N-(1,3-dioxoisoindol-5-yl)pyrrolidine-2-carboxamide (PubChem CID 25303397) has the molecular formula C17H14ClN3O5S2 and a molecular weight of 439.90 g/mol. Its IUPAC name is (2R)-1-(5-chlorothiophen-2-yl)sulfonyl-N-(1,3-dioxoisoindol-5-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-(5-chlorothiophen-2-yl)sulfonyl-N-(1,3-dioxoisoindol-5-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 25303397 |
| Molecular Formula | C17H14ClN3O5S2 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.01 |
| IUPAC Name | (2R)-1-(5-chlorothiophen-2-yl)sulfonyl-N-(1,3-dioxoisoindol-5-yl)pyrrolidine-2-carboxamide |
| SMILES | O=C1NC(=O)c2cc(NC(=O)[C@H]3CCCN3S(=O)(=O)c3ccc(Cl)s3)ccc21 |
| InChI | InChI=1S/C17H14ClN3O5S2/c18-13-5-6-14(27-13)28(25,26)21-7-1-2-12(21)17(24)19-9-3-4-10-11(8-9)16(23)20-15(10)22/h3-6,8,12H,1-2,7H2,(H,19,24)(H,20,22,23)/t12-/m1/s1 |
| InChIKey | DQBOZFDVOOBMIA-GFCCVEGCSA-N |
| XLogP | 2.08 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|