C9H9ClNO4S2- — CID 7063076
(2S)-1-(5-chlorothiophen-2-yl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 7063076) has the molecular formula C9H9ClNO4S2- and a molecular weight of 294.76 g/mol. Its IUPAC name is (2S)-1-(5-chlorothiophen-2-yl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | (2S)-1-(5-chlorothiophen-2-yl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 7063076 |
| Molecular Formula | C9H9ClNO4S2- |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | (2S)-1-(5-chlorothiophen-2-yl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | O=C([O-])[C@@H]1CCCN1S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C9H10ClNO4S2/c10-7-3-4-8(16-7)17(14,15)11-5-1-2-6(11)9(12)13/h3-4,6H,1-2,5H2,(H,12,13)/p-1/t6-/m0/s1 |
| InChIKey | UYVXUYVAIIWBSW-LURJTMIESA-M |
| XLogP | 0.30 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |