C11H11ClN2O4S2 — CID 42938484
cyanomethyl 1-(5-chlorothiophen-2-yl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 42938484) has the molecular formula C11H11ClN2O4S2 and a molecular weight of 334.81 g/mol. Its IUPAC name is cyanomethyl 1-(5-chlorothiophen-2-yl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | cyanomethyl 1-(5-chlorothiophen-2-yl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 42938484 |
| Molecular Formula | C11H11ClN2O4S2 |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | cyanomethyl 1-(5-chlorothiophen-2-yl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | N#CCOC(=O)C1CCCN1S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H11ClN2O4S2/c12-9-3-4-10(19-9)20(16,17)14-6-1-2-8(14)11(15)18-7-5-13/h3-4,8H,1-2,6-7H2 |
| InChIKey | JUFWBTYOPVYKKC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |