C9H12ClNO2S2 — CID 110728237
1-(5-chlorothiophen-2-yl)sulfonyl-2-methylpyrrolidine (PubChem CID 110728237) has the molecular formula C9H12ClNO2S2 and a molecular weight of 265.79 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-2-methylpyrrolidine.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-2-methylpyrrolidine |
|---|---|
| PubChem CID | 110728237 |
| Molecular Formula | C9H12ClNO2S2 |
| Molecular Weight | 265.79 g/mol |
| Exact Mass | 265.00 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-2-methylpyrrolidine |
| SMILES | CC1CCCN1S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C9H12ClNO2S2/c1-7-3-2-6-11(7)15(12,13)9-5-4-8(10)14-9/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | XHHDBTIYYQCCOE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.79 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |