C13H13ClN2O2S2 — CID 47387683
2-[1-(5-chlorothiophen-2-yl)sulfonylpyrrolidin-2-yl]pyridine (PubChem CID 47387683) has the molecular formula C13H13ClN2O2S2 and a molecular weight of 328.85 g/mol. Its IUPAC name is 2-[1-(5-chlorothiophen-2-yl)sulfonylpyrrolidin-2-yl]pyridine.
| Compound Name | 2-[1-(5-chlorothiophen-2-yl)sulfonylpyrrolidin-2-yl]pyridine |
|---|---|
| PubChem CID | 47387683 |
| Molecular Formula | C13H13ClN2O2S2 |
| Molecular Weight | 328.85 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 2-[1-(5-chlorothiophen-2-yl)sulfonylpyrrolidin-2-yl]pyridine |
| SMILES | O=S(=O)(c1ccc(Cl)s1)N1CCCC1c1ccccn1 |
| InChI | InChI=1S/C13H13ClN2O2S2/c14-12-6-7-13(19-12)20(17,18)16-9-3-5-11(16)10-4-1-2-8-15-10/h1-2,4,6-8,11H,3,5,9H2 |
| InChIKey | UGVPPGNGECNWSS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.85 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |