C15H16ClN3O3S2 — CID 24672059
1-(5-chlorothiophen-2-yl)sulfonyl-N-(pyridin-2-ylmethyl)pyrrolidine-2-carboxamide (PubChem CID 24672059) has the molecular formula C15H16ClN3O3S2 and a molecular weight of 385.90 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-N-(pyridin-2-ylmethyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-N-(pyridin-2-ylmethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 24672059 |
| Molecular Formula | C15H16ClN3O3S2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-N-(pyridin-2-ylmethyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCc1ccccn1)C1CCCN1S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H16ClN3O3S2/c16-13-6-7-14(23-13)24(21,22)19-9-3-5-12(19)15(20)18-10-11-4-1-2-8-17-11/h1-2,4,6-8,12H,3,5,9-10H2,(H,18,20) |
| InChIKey | HELQCVJGBTXJRM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |