C15H16ClNO4S3 — CID 90585727
2-(benzenesulfonylmethyl)-1-(5-chlorothiophen-2-yl)sulfonylpyrrolidine (PubChem CID 90585727) has the molecular formula C15H16ClNO4S3 and a molecular weight of 405.95 g/mol. Its IUPAC name is 2-(benzenesulfonylmethyl)-1-(5-chlorothiophen-2-yl)sulfonylpyrrolidine.
| Compound Name | 2-(benzenesulfonylmethyl)-1-(5-chlorothiophen-2-yl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 90585727 |
| Molecular Formula | C15H16ClNO4S3 |
| Molecular Weight | 405.95 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | 2-(benzenesulfonylmethyl)-1-(5-chlorothiophen-2-yl)sulfonylpyrrolidine |
| SMILES | O=S(=O)(CC1CCCN1S(=O)(=O)c1ccc(Cl)s1)c1ccccc1 |
| InChI | InChI=1S/C15H16ClNO4S3/c16-14-8-9-15(22-14)24(20,21)17-10-4-5-12(17)11-23(18,19)13-6-2-1-3-7-13/h1-3,6-9,12H,4-5,10-11H2 |
| InChIKey | ANIVPDLPLQCXGE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.95 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |