C12H12ClNO2S3 — CID 51550798
(2S)-1-(5-chlorothiophen-2-yl)sulfonyl-2-thiophen-2-ylpyrrolidine (PubChem CID 51550798) has the molecular formula C12H12ClNO2S3 and a molecular weight of 333.89 g/mol. Its IUPAC name is (2S)-1-(5-chlorothiophen-2-yl)sulfonyl-2-thiophen-2-ylpyrrolidine.
| Compound Name | (2S)-1-(5-chlorothiophen-2-yl)sulfonyl-2-thiophen-2-ylpyrrolidine |
|---|---|
| PubChem CID | 51550798 |
| Molecular Formula | C12H12ClNO2S3 |
| Molecular Weight | 333.89 g/mol |
| Exact Mass | 332.97 |
| IUPAC Name | (2S)-1-(5-chlorothiophen-2-yl)sulfonyl-2-thiophen-2-ylpyrrolidine |
| SMILES | O=S(=O)(c1ccc(Cl)s1)N1CCC[C@H]1c1cccs1 |
| InChI | InChI=1S/C12H12ClNO2S3/c13-11-5-6-12(18-11)19(15,16)14-7-1-3-9(14)10-4-2-8-17-10/h2,4-6,8-9H,1,3,7H2/t9-/m0/s1 |
| InChIKey | UGTBIAJCFVRLNI-VIFPVBQESA-N |
| XLogP | 3.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.89 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |