C14H14FNO2S2 — CID 18170893
1-(3-fluorophenyl)sulfonyl-2-thiophen-2-ylpyrrolidine (PubChem CID 18170893) has the molecular formula C14H14FNO2S2 and a molecular weight of 311.40 g/mol. Its IUPAC name is 1-(3-fluorophenyl)sulfonyl-2-thiophen-2-ylpyrrolidine.
| Compound Name | 1-(3-fluorophenyl)sulfonyl-2-thiophen-2-ylpyrrolidine |
|---|---|
| PubChem CID | 18170893 |
| Molecular Formula | C14H14FNO2S2 |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 1-(3-fluorophenyl)sulfonyl-2-thiophen-2-ylpyrrolidine |
| SMILES | O=S(=O)(c1cccc(F)c1)N1CCCC1c1cccs1 |
| InChI | InChI=1S/C14H14FNO2S2/c15-11-4-1-5-12(10-11)20(17,18)16-8-2-6-13(16)14-7-3-9-19-14/h1,3-5,7,9-10,13H,2,6,8H2 |
| InChIKey | CBQXHBIXUYWHMN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |