C17H16FNO4S — CID 126778989
2-(1,3-benzodioxol-5-yl)-1-(3-fluorophenyl)sulfonylpyrrolidine (PubChem CID 126778989) has the molecular formula C17H16FNO4S and a molecular weight of 349.38 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1-(3-fluorophenyl)sulfonylpyrrolidine.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1-(3-fluorophenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 126778989 |
| Molecular Formula | C17H16FNO4S |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1-(3-fluorophenyl)sulfonylpyrrolidine |
| SMILES | O=S(=O)(c1cccc(F)c1)N1CCCC1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H16FNO4S/c18-13-3-1-4-14(10-13)24(20,21)19-8-2-5-15(19)12-6-7-16-17(9-12)23-11-22-16/h1,3-4,6-7,9-10,15H,2,5,8,11H2 |
| InChIKey | BEJYTAGKNUKUIH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |