C16H16N2O4S — CID 110871717
2-[1-(1,3-benzodioxol-5-ylsulfonyl)pyrrolidin-2-yl]pyridine (PubChem CID 110871717) has the molecular formula C16H16N2O4S and a molecular weight of 332.38 g/mol. Its IUPAC name is 2-[1-(1,3-benzodioxol-5-ylsulfonyl)pyrrolidin-2-yl]pyridine.
| Compound Name | 2-[1-(1,3-benzodioxol-5-ylsulfonyl)pyrrolidin-2-yl]pyridine |
|---|---|
| PubChem CID | 110871717 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 2-[1-(1,3-benzodioxol-5-ylsulfonyl)pyrrolidin-2-yl]pyridine |
| SMILES | O=S(=O)(c1ccc2c(c1)OCO2)N1CCCC1c1ccccn1 |
| InChI | InChI=1S/C16H16N2O4S/c19-23(20,12-6-7-15-16(10-12)22-11-21-15)18-9-3-5-14(18)13-4-1-2-8-17-13/h1-2,4,6-8,10,14H,3,5,9,11H2 |
| InChIKey | FKMUOOGCFVBGIN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |