C18H18N2O3 — CID 70759267
1,3-benzodioxol-5-yl-(2-pyridin-2-ylpiperidin-1-yl)methanone (PubChem CID 70759267) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-(2-pyridin-2-ylpiperidin-1-yl)methanone.
| Compound Name | 1,3-benzodioxol-5-yl-(2-pyridin-2-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 70759267 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 1,3-benzodioxol-5-yl-(2-pyridin-2-ylpiperidin-1-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)OCO2)N1CCCCC1c1ccccn1 |
| InChI | InChI=1S/C18H18N2O3/c21-18(13-7-8-16-17(11-13)23-12-22-16)20-10-4-2-6-15(20)14-5-1-3-9-19-14/h1,3,5,7-9,11,15H,2,4,6,10,12H2 |
| InChIKey | QZHBRBBMNSMPNF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |