C16H15ClN2O — CID 47380034
(3-chlorophenyl)-(2-pyridin-2-ylpyrrolidin-1-yl)methanone (PubChem CID 47380034) has the molecular formula C16H15ClN2O and a molecular weight of 286.76 g/mol. Its IUPAC name is (3-chlorophenyl)-(2-pyridin-2-ylpyrrolidin-1-yl)methanone.
| Compound Name | (3-chlorophenyl)-(2-pyridin-2-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 47380034 |
| Molecular Formula | C16H15ClN2O |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | (3-chlorophenyl)-(2-pyridin-2-ylpyrrolidin-1-yl)methanone |
| SMILES | O=C(c1cccc(Cl)c1)N1CCCC1c1ccccn1 |
| InChI | InChI=1S/C16H15ClN2O/c17-13-6-3-5-12(11-13)16(20)19-10-4-8-15(19)14-7-1-2-9-18-14/h1-3,5-7,9,11,15H,4,8,10H2 |
| InChIKey | XHNUETKLVLHQIO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |