C16H16ClN3O — CID 110874701
N-(3-chlorophenyl)-2-pyridin-2-ylpyrrolidine-1-carboxamide (PubChem CID 110874701) has the molecular formula C16H16ClN3O and a molecular weight of 301.78 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-pyridin-2-ylpyrrolidine-1-carboxamide.
| Compound Name | N-(3-chlorophenyl)-2-pyridin-2-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 110874701 |
| Molecular Formula | C16H16ClN3O |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N-(3-chlorophenyl)-2-pyridin-2-ylpyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)N1CCCC1c1ccccn1 |
| InChI | InChI=1S/C16H16ClN3O/c17-12-5-3-6-13(11-12)19-16(21)20-10-4-8-15(20)14-7-1-2-9-18-14/h1-3,5-7,9,11,15H,4,8,10H2,(H,19,21) |
| InChIKey | YEHCYVIBTQEQHQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |