C20H21N3O2 — CID 118779586
N-(2-methyl-1-benzofuran-5-yl)-2-pyridin-2-ylpiperidine-1-carboxamide (PubChem CID 118779586) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is N-(2-methyl-1-benzofuran-5-yl)-2-pyridin-2-ylpiperidine-1-carboxamide.
| Compound Name | N-(2-methyl-1-benzofuran-5-yl)-2-pyridin-2-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 118779586 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | N-(2-methyl-1-benzofuran-5-yl)-2-pyridin-2-ylpiperidine-1-carboxamide |
| SMILES | Cc1cc2cc(NC(=O)N3CCCCC3c3ccccn3)ccc2o1 |
| InChI | InChI=1S/C20H21N3O2/c1-14-12-15-13-16(8-9-19(15)25-14)22-20(24)23-11-5-3-7-18(23)17-6-2-4-10-21-17/h2,4,6,8-10,12-13,18H,3,5,7,11H2,1H3,(H,22,24) |
| InChIKey | DNGBZLUQCBJUJE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |