C18H17Cl2N3O2 — CID 1445725
(2S)-1-N,2-N-bis(3-chlorophenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 1445725) has the molecular formula C18H17Cl2N3O2 and a molecular weight of 378.26 g/mol. Its IUPAC name is (2S)-1-N,2-N-bis(3-chlorophenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S)-1-N,2-N-bis(3-chlorophenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 1445725 |
| Molecular Formula | C18H17Cl2N3O2 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | (2S)-1-N,2-N-bis(3-chlorophenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)[C@@H]1CCCN1C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H17Cl2N3O2/c19-12-4-1-6-14(10-12)21-17(24)16-8-3-9-23(16)18(25)22-15-7-2-5-13(20)11-15/h1-2,4-7,10-11,16H,3,8-9H2,(H,21,24)(H,22,25)/t16-/m0/s1 |
| InChIKey | JMEZUUCROYSHFE-INIZCTEOSA-N |
| XLogP | 4.63 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |