C21H24N4O3 — CID 1442935
(2R)-2-N-(3-acetamidophenyl)-1-N-(3-methylphenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 1442935) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is (2R)-2-N-(3-acetamidophenyl)-1-N-(3-methylphenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R)-2-N-(3-acetamidophenyl)-1-N-(3-methylphenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 1442935 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (2R)-2-N-(3-acetamidophenyl)-1-N-(3-methylphenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)[C@H]2CCCN2C(=O)Nc2cccc(C)c2)c1 |
| InChI | InChI=1S/C21H24N4O3/c1-14-6-3-7-16(12-14)24-21(28)25-11-5-10-19(25)20(27)23-18-9-4-8-17(13-18)22-15(2)26/h3-4,6-9,12-13,19H,5,10-11H2,1-2H3,(H,22,26)(H,23,27)(H,24,28)/t19-/m1/s1 |
| InChIKey | QJGFSTQCJQPHDD-LJQANCHMSA-N |
| XLogP | 3.59 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |