C16H23N3O2 — CID 1442922
(2R)-1-N-(3-methylphenyl)-2-N-propan-2-ylpyrrolidine-1,2-dicarboxamide (PubChem CID 1442922) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is (2R)-1-N-(3-methylphenyl)-2-N-propan-2-ylpyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R)-1-N-(3-methylphenyl)-2-N-propan-2-ylpyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 1442922 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | (2R)-1-N-(3-methylphenyl)-2-N-propan-2-ylpyrrolidine-1,2-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)N2CCC[C@@H]2C(=O)NC(C)C)c1 |
| InChI | InChI=1S/C16H23N3O2/c1-11(2)17-15(20)14-8-5-9-19(14)16(21)18-13-7-4-6-12(3)10-13/h4,6-7,10-11,14H,5,8-9H2,1-3H3,(H,17,20)(H,18,21)/t14-/m1/s1 |
| InChIKey | FZHWWAMDUMGFNB-CQSZACIVSA-N |
| XLogP | 2.52 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |