C15H20ClN3O2 — CID 3219672
1-N-(4-chlorophenyl)-2-N-propan-2-ylpyrrolidine-1,2-dicarboxamide (PubChem CID 3219672) has the molecular formula C15H20ClN3O2 and a molecular weight of 309.80 g/mol. Its IUPAC name is 1-N-(4-chlorophenyl)-2-N-propan-2-ylpyrrolidine-1,2-dicarboxamide.
| Compound Name | 1-N-(4-chlorophenyl)-2-N-propan-2-ylpyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 3219672 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 1-N-(4-chlorophenyl)-2-N-propan-2-ylpyrrolidine-1,2-dicarboxamide |
| SMILES | CC(C)NC(=O)C1CCCN1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H20ClN3O2/c1-10(2)17-14(20)13-4-3-9-19(13)15(21)18-12-7-5-11(16)6-8-12/h5-8,10,13H,3-4,9H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | FXYQBJFHCTXOLV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |