C19H25ClN2O2 — CID 110354039
(2S)-N-(4-chlorophenyl)-1-(2-cyclopentylpropanoyl)pyrrolidine-2-carboxamide (PubChem CID 110354039) has the molecular formula C19H25ClN2O2 and a molecular weight of 348.87 g/mol. Its IUPAC name is (2S)-N-(4-chlorophenyl)-1-(2-cyclopentylpropanoyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(4-chlorophenyl)-1-(2-cyclopentylpropanoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110354039 |
| Molecular Formula | C19H25ClN2O2 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (2S)-N-(4-chlorophenyl)-1-(2-cyclopentylpropanoyl)pyrrolidine-2-carboxamide |
| SMILES | CC(C(=O)N1CCC[C@H]1C(=O)Nc1ccc(Cl)cc1)C1CCCC1 |
| InChI | InChI=1S/C19H25ClN2O2/c1-13(14-5-2-3-6-14)19(24)22-12-4-7-17(22)18(23)21-16-10-8-15(20)9-11-16/h8-11,13-14,17H,2-7,12H2,1H3,(H,21,23)/t13?,17-/m0/s1 |
| InChIKey | ZUSWXFKASCSRBJ-RUINGEJQSA-N |
| XLogP | 4.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |