C23H33N3O3 — CID 91170695
1-[2-cyclohexyl-2-(2-methylpropanoylamino)acetyl]-N-phenylpyrrolidine-2-carboxamide (PubChem CID 91170695) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is 1-[2-cyclohexyl-2-(2-methylpropanoylamino)acetyl]-N-phenylpyrrolidine-2-carboxamide.
| Compound Name | 1-[2-cyclohexyl-2-(2-methylpropanoylamino)acetyl]-N-phenylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 91170695 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | 1-[2-cyclohexyl-2-(2-methylpropanoylamino)acetyl]-N-phenylpyrrolidine-2-carboxamide |
| SMILES | CC(C)C(=O)NC(C(=O)N1CCCC1C(=O)Nc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C23H33N3O3/c1-16(2)21(27)25-20(17-10-5-3-6-11-17)23(29)26-15-9-14-19(26)22(28)24-18-12-7-4-8-13-18/h4,7-8,12-13,16-17,19-20H,3,5-6,9-11,14-15H2,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | QRLCOWZPDUNUAT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |