C21H24N4O2 — CID 60527303
1-(2-methylpropanoyl)-N-(4-phenyldiazenylphenyl)pyrrolidine-2-carboxamide (PubChem CID 60527303) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-(2-methylpropanoyl)-N-(4-phenyldiazenylphenyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(2-methylpropanoyl)-N-(4-phenyldiazenylphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 60527303 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 1-(2-methylpropanoyl)-N-(4-phenyldiazenylphenyl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)C(=O)N1CCCC1C(=O)Nc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C21H24N4O2/c1-15(2)21(27)25-14-6-9-19(25)20(26)22-16-10-12-18(13-11-16)24-23-17-7-4-3-5-8-17/h3-5,7-8,10-13,15,19H,6,9,14H2,1-2H3,(H,22,26)/b24-23+ |
| InChIKey | ODIDSDBPMGRUBQ-WCWDXBQESA-N |
| XLogP | 4.69 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|