C18H27N3O4S — CID 55875608
1-(2-methylpropanoyl)-N-[4-(propan-2-ylsulfamoyl)phenyl]pyrrolidine-2-carboxamide (PubChem CID 55875608) has the molecular formula C18H27N3O4S and a molecular weight of 381.50 g/mol. Its IUPAC name is 1-(2-methylpropanoyl)-N-[4-(propan-2-ylsulfamoyl)phenyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(2-methylpropanoyl)-N-[4-(propan-2-ylsulfamoyl)phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55875608 |
| Molecular Formula | C18H27N3O4S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 1-(2-methylpropanoyl)-N-[4-(propan-2-ylsulfamoyl)phenyl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(NC(=O)C2CCCN2C(=O)C(C)C)cc1 |
| InChI | InChI=1S/C18H27N3O4S/c1-12(2)18(23)21-11-5-6-16(21)17(22)19-14-7-9-15(10-8-14)26(24,25)20-13(3)4/h7-10,12-13,16,20H,5-6,11H2,1-4H3,(H,19,22) |
| InChIKey | VGGNIZSGAJNXFI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |