C21H27N3O5S2 — CID 55335881
1-(4-methylphenyl)sulfonyl-N-[4-(propan-2-ylsulfamoyl)phenyl]pyrrolidine-2-carboxamide (PubChem CID 55335881) has the molecular formula C21H27N3O5S2 and a molecular weight of 465.60 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-N-[4-(propan-2-ylsulfamoyl)phenyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(4-methylphenyl)sulfonyl-N-[4-(propan-2-ylsulfamoyl)phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55335881 |
| Molecular Formula | C21H27N3O5S2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-N-[4-(propan-2-ylsulfamoyl)phenyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC2C(=O)Nc2ccc(S(=O)(=O)NC(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H27N3O5S2/c1-15(2)23-30(26,27)18-12-8-17(9-13-18)22-21(25)20-5-4-14-24(20)31(28,29)19-10-6-16(3)7-11-19/h6-13,15,20,23H,4-5,14H2,1-3H3,(H,22,25) |
| InChIKey | FRTLFSOLHRBAIC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |