C19H20ClN3O6S2 — CID 2095948
(2R)-N-[4-(acetylsulfamoyl)phenyl]-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 2095948) has the molecular formula C19H20ClN3O6S2 and a molecular weight of 485.97 g/mol. Its IUPAC name is (2R)-N-[4-(acetylsulfamoyl)phenyl]-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[4-(acetylsulfamoyl)phenyl]-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 2095948 |
| Molecular Formula | C19H20ClN3O6S2 |
| Molecular Weight | 485.97 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | (2R)-N-[4-(acetylsulfamoyl)phenyl]-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NC(=O)[C@H]2CCCN2S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H20ClN3O6S2/c1-13(24)22-30(26,27)16-10-6-15(7-11-16)21-19(25)18-3-2-12-23(18)31(28,29)17-8-4-14(20)5-9-17/h4-11,18H,2-3,12H2,1H3,(H,21,25)(H,22,24)/t18-/m1/s1 |
| InChIKey | DOVYINBVTXESEY-GOSISDBHSA-N |
| XLogP | 1.96 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.97 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |