C21H25N3O4S — CID 8701358
(2R)-N-(4-acetamidophenyl)-1-(4-methylphenyl)sulfonylpiperidine-2-carboxamide (PubChem CID 8701358) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is (2R)-N-(4-acetamidophenyl)-1-(4-methylphenyl)sulfonylpiperidine-2-carboxamide.
| Compound Name | (2R)-N-(4-acetamidophenyl)-1-(4-methylphenyl)sulfonylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 8701358 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (2R)-N-(4-acetamidophenyl)-1-(4-methylphenyl)sulfonylpiperidine-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)[C@H]2CCCCN2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H25N3O4S/c1-15-6-12-19(13-7-15)29(27,28)24-14-4-3-5-20(24)21(26)23-18-10-8-17(9-11-18)22-16(2)25/h6-13,20H,3-5,14H2,1-2H3,(H,22,25)(H,23,26)/t20-/m1/s1 |
| InChIKey | PKXNKLOFHUCOLB-HXUWFJFHSA-N |
| XLogP | 3.14 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |