C14H17N2O5S- — CID 7058608
(2R)-1-(4-acetamidophenyl)sulfonylpiperidine-2-carboxylate (PubChem CID 7058608) has the molecular formula C14H17N2O5S- and a molecular weight of 325.37 g/mol. Its IUPAC name is (2R)-1-(4-acetamidophenyl)sulfonylpiperidine-2-carboxylate.
| Compound Name | (2R)-1-(4-acetamidophenyl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 7058608 |
| Molecular Formula | C14H17N2O5S- |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | (2R)-1-(4-acetamidophenyl)sulfonylpiperidine-2-carboxylate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCCC[C@@H]2C(=O)[O-])cc1 |
| InChI | InChI=1S/C14H18N2O5S/c1-10(17)15-11-5-7-12(8-6-11)22(20,21)16-9-3-2-4-13(16)14(18)19/h5-8,13H,2-4,9H2,1H3,(H,15,17)(H,18,19)/p-1/t13-/m1/s1 |
| InChIKey | BGVXSLAPWITTFG-CYBMUJFWSA-M |
| XLogP | -0.06 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |