C20H22ClN3O4 — CID 51508333
(2R)-1-N-(3-chlorophenyl)-2-N-(2,6-dimethoxyphenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 51508333) has the molecular formula C20H22ClN3O4 and a molecular weight of 403.87 g/mol. Its IUPAC name is (2R)-1-N-(3-chlorophenyl)-2-N-(2,6-dimethoxyphenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R)-1-N-(3-chlorophenyl)-2-N-(2,6-dimethoxyphenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 51508333 |
| Molecular Formula | C20H22ClN3O4 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | (2R)-1-N-(3-chlorophenyl)-2-N-(2,6-dimethoxyphenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | COc1cccc(OC)c1NC(=O)[C@H]1CCCN1C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H22ClN3O4/c1-27-16-9-4-10-17(28-2)18(16)23-19(25)15-8-5-11-24(15)20(26)22-14-7-3-6-13(21)12-14/h3-4,6-7,9-10,12,15H,5,8,11H2,1-2H3,(H,22,26)(H,23,25)/t15-/m1/s1 |
| InChIKey | CIQQCBHUAAYRKD-OAHLLOKOSA-N |
| XLogP | 3.99 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |