C15H16ClN3O2 — CID 124617199
(3-chlorophenyl)-[(2S)-2-(1,2,4-oxadiazol-3-yl)azepan-1-yl]methanone (PubChem CID 124617199) has the molecular formula C15H16ClN3O2 and a molecular weight of 305.76 g/mol. Its IUPAC name is (3-chlorophenyl)-[(2S)-2-(1,2,4-oxadiazol-3-yl)azepan-1-yl]methanone.
| Compound Name | (3-chlorophenyl)-[(2S)-2-(1,2,4-oxadiazol-3-yl)azepan-1-yl]methanone |
|---|---|
| PubChem CID | 124617199 |
| Molecular Formula | C15H16ClN3O2 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | (3-chlorophenyl)-[(2S)-2-(1,2,4-oxadiazol-3-yl)azepan-1-yl]methanone |
| SMILES | O=C(c1cccc(Cl)c1)N1CCCCC[C@H]1c1ncon1 |
| InChI | InChI=1S/C15H16ClN3O2/c16-12-6-4-5-11(9-12)15(20)19-8-3-1-2-7-13(19)14-17-10-21-18-14/h4-6,9-10,13H,1-3,7-8H2/t13-/m0/s1 |
| InChIKey | IXDYHFGDWKROIK-ZDUSSCGKSA-N |
| XLogP | 3.48 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |