C16H13ClF2N2O — CID 94803151
(2-chloro-4,5-difluorophenyl)-[(2R)-2-pyridin-2-ylpyrrolidin-1-yl]methanone (PubChem CID 94803151) has the molecular formula C16H13ClF2N2O and a molecular weight of 322.74 g/mol. Its IUPAC name is (2-chloro-4,5-difluorophenyl)-[(2R)-2-pyridin-2-ylpyrrolidin-1-yl]methanone.
| Compound Name | (2-chloro-4,5-difluorophenyl)-[(2R)-2-pyridin-2-ylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 94803151 |
| Molecular Formula | C16H13ClF2N2O |
| Molecular Weight | 322.74 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | (2-chloro-4,5-difluorophenyl)-[(2R)-2-pyridin-2-ylpyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cc(F)c(F)cc1Cl)N1CCC[C@@H]1c1ccccn1 |
| InChI | InChI=1S/C16H13ClF2N2O/c17-11-9-13(19)12(18)8-10(11)16(22)21-7-3-5-15(21)14-4-1-2-6-20-14/h1-2,4,6,8-9,15H,3,5,7H2/t15-/m1/s1 |
| InChIKey | WATOFAHMRPIBPA-OAHLLOKOSA-N |
| XLogP | 3.99 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.74 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|