C15H12ClF2NO2 — CID 20895629
(2-chloro-4,5-difluorophenyl)-[2-(furan-2-yl)pyrrolidin-1-yl]methanone (PubChem CID 20895629) has the molecular formula C15H12ClF2NO2 and a molecular weight of 311.72 g/mol. Its IUPAC name is (2-chloro-4,5-difluorophenyl)-[2-(furan-2-yl)pyrrolidin-1-yl]methanone.
| Compound Name | (2-chloro-4,5-difluorophenyl)-[2-(furan-2-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 20895629 |
| Molecular Formula | C15H12ClF2NO2 |
| Molecular Weight | 311.72 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | (2-chloro-4,5-difluorophenyl)-[2-(furan-2-yl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cc(F)c(F)cc1Cl)N1CCCC1c1ccco1 |
| InChI | InChI=1S/C15H12ClF2NO2/c16-10-8-12(18)11(17)7-9(10)15(20)19-5-1-3-13(19)14-4-2-6-21-14/h2,4,6-8,13H,1,3,5H2 |
| InChIKey | DSULWPLMEMFZSN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.72 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|