C16H15NO4 — CID 124701060
4-[(2S)-2-(furan-2-yl)pyrrolidine-1-carbonyl]benzoic acid (PubChem CID 124701060) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is 4-[(2S)-2-(furan-2-yl)pyrrolidine-1-carbonyl]benzoic acid.
| Compound Name | 4-[(2S)-2-(furan-2-yl)pyrrolidine-1-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 124701060 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 4-[(2S)-2-(furan-2-yl)pyrrolidine-1-carbonyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)N2CCC[C@H]2c2ccco2)cc1 |
| InChI | InChI=1S/C16H15NO4/c18-15(11-5-7-12(8-6-11)16(19)20)17-9-1-3-13(17)14-4-2-10-21-14/h2,4-8,10,13H,1,3,9H2,(H,19,20)/t13-/m0/s1 |
| InChIKey | VYKYUNLZHZBPGT-ZDUSSCGKSA-N |
| XLogP | 2.96 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |