C15H22N2O2 — CID 95728453
[(2S)-2-(furan-2-yl)azepan-1-yl]-pyrrolidin-1-ylmethanone (PubChem CID 95728453) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is [(2S)-2-(furan-2-yl)azepan-1-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(2S)-2-(furan-2-yl)azepan-1-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 95728453 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | [(2S)-2-(furan-2-yl)azepan-1-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(N1CCCC1)N1CCCCC[C@H]1c1ccco1 |
| InChI | InChI=1S/C15H22N2O2/c18-15(16-9-4-5-10-16)17-11-3-1-2-7-13(17)14-8-6-12-19-14/h6,8,12-13H,1-5,7,9-11H2/t13-/m0/s1 |
| InChIKey | TUJIFUSBNSJXKD-ZDUSSCGKSA-N |
| XLogP | 3.41 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |