C14H21NO3 — CID 124500862
tert-butyl (2S)-2-(furan-2-yl)piperidine-1-carboxylate (PubChem CID 124500862) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is tert-butyl (2S)-2-(furan-2-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(furan-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 124500862 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | tert-butyl (2S)-2-(furan-2-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@H]1c1ccco1 |
| InChI | InChI=1S/C14H21NO3/c1-14(2,3)18-13(16)15-9-5-4-7-11(15)12-8-6-10-17-12/h6,8,10-11H,4-5,7,9H2,1-3H3/t11-/m0/s1 |
| InChIKey | XFMRBFGFKMIXOX-NSHDSACASA-N |
| XLogP | 3.74 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |