C18H27NO5 — CID 57189785
ditert-butyl (2S)-5-(furan-2-yl)pyrrolidine-1,2-dicarboxylate (PubChem CID 57189785) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is ditert-butyl (2S)-5-(furan-2-yl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2S)-5-(furan-2-yl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 57189785 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | ditert-butyl (2S)-5-(furan-2-yl)pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCC(c2ccco2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27NO5/c1-17(2,3)23-15(20)13-10-9-12(14-8-7-11-22-14)19(13)16(21)24-18(4,5)6/h7-8,11-13H,9-10H2,1-6H3/t12?,13-/m0/s1 |
| InChIKey | NMAMBMIVLMVVGE-ABLWVSNPSA-N |
| XLogP | 4.06 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |