C10H13NO2 — CID 124500835
1-[(2R)-2-(furan-2-yl)pyrrolidin-1-yl]ethanone (PubChem CID 124500835) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-[(2R)-2-(furan-2-yl)pyrrolidin-1-yl]ethanone.
| Compound Name | 1-[(2R)-2-(furan-2-yl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 124500835 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1-[(2R)-2-(furan-2-yl)pyrrolidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC[C@@H]1c1ccco1 |
| InChI | InChI=1S/C10H13NO2/c1-8(12)11-6-2-4-9(11)10-5-3-7-13-10/h3,5,7,9H,2,4,6H2,1H3/t9-/m1/s1 |
| InChIKey | MJHCONDNLSHLCI-SECBINFHSA-N |
| XLogP | 1.96 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |