C14H15NO5S — CID 86960921
[2-(furan-2-yl)pyrrolidin-1-yl]-(5-methylsulfonylfuran-2-yl)methanone (PubChem CID 86960921) has the molecular formula C14H15NO5S and a molecular weight of 309.34 g/mol. Its IUPAC name is [2-(furan-2-yl)pyrrolidin-1-yl]-(5-methylsulfonylfuran-2-yl)methanone.
| Compound Name | [2-(furan-2-yl)pyrrolidin-1-yl]-(5-methylsulfonylfuran-2-yl)methanone |
|---|---|
| PubChem CID | 86960921 |
| Molecular Formula | C14H15NO5S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | [2-(furan-2-yl)pyrrolidin-1-yl]-(5-methylsulfonylfuran-2-yl)methanone |
| SMILES | CS(=O)(=O)c1ccc(C(=O)N2CCCC2c2ccco2)o1 |
| InChI | InChI=1S/C14H15NO5S/c1-21(17,18)13-7-6-12(20-13)14(16)15-8-2-4-10(15)11-5-3-9-19-11/h3,5-7,9-10H,2,4,8H2,1H3 |
| InChIKey | HEYWKZYJEWMORJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 80.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |