C17H21NO3S — CID 70706464
[2-(furan-2-yl)azepan-1-yl]-[5-(methylsulfanylmethyl)furan-2-yl]methanone (PubChem CID 70706464) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is [2-(furan-2-yl)azepan-1-yl]-[5-(methylsulfanylmethyl)furan-2-yl]methanone.
| Compound Name | [2-(furan-2-yl)azepan-1-yl]-[5-(methylsulfanylmethyl)furan-2-yl]methanone |
|---|---|
| PubChem CID | 70706464 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | [2-(furan-2-yl)azepan-1-yl]-[5-(methylsulfanylmethyl)furan-2-yl]methanone |
| SMILES | CSCc1ccc(C(=O)N2CCCCCC2c2ccco2)o1 |
| InChI | InChI=1S/C17H21NO3S/c1-22-12-13-8-9-16(21-13)17(19)18-10-4-2-3-6-14(18)15-7-5-11-20-15/h5,7-9,11,14H,2-4,6,10,12H2,1H3 |
| InChIKey | CERWNXSRFZIVHZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 46.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |