C19H25NO5S — CID 96996576
[(2R)-2-(5-ethylfuran-2-yl)azepan-1-yl]-[5-(methylsulfonylmethyl)furan-2-yl]methanone (PubChem CID 96996576) has the molecular formula C19H25NO5S and a molecular weight of 379.48 g/mol. Its IUPAC name is [(2R)-2-(5-ethylfuran-2-yl)azepan-1-yl]-[5-(methylsulfonylmethyl)furan-2-yl]methanone.
| Compound Name | [(2R)-2-(5-ethylfuran-2-yl)azepan-1-yl]-[5-(methylsulfonylmethyl)furan-2-yl]methanone |
|---|---|
| PubChem CID | 96996576 |
| Molecular Formula | C19H25NO5S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | [(2R)-2-(5-ethylfuran-2-yl)azepan-1-yl]-[5-(methylsulfonylmethyl)furan-2-yl]methanone |
| SMILES | CCc1ccc([C@H]2CCCCCN2C(=O)c2ccc(CS(C)(=O)=O)o2)o1 |
| InChI | InChI=1S/C19H25NO5S/c1-3-14-8-10-17(24-14)16-7-5-4-6-12-20(16)19(21)18-11-9-15(25-18)13-26(2,22)23/h8-11,16H,3-7,12-13H2,1-2H3/t16-/m1/s1 |
| InChIKey | YSBLNIRYSTVISD-MRXNPFEDSA-N |
| XLogP | 3.74 |
| TPSA | 80.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |