C16H21NO6S — CID 119169268
1-[5-(methylsulfonylmethyl)furan-2-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 119169268) has the molecular formula C16H21NO6S and a molecular weight of 355.41 g/mol. Its IUPAC name is 1-[5-(methylsulfonylmethyl)furan-2-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | 1-[5-(methylsulfonylmethyl)furan-2-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 119169268 |
| Molecular Formula | C16H21NO6S |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 1-[5-(methylsulfonylmethyl)furan-2-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | CS(=O)(=O)Cc1ccc(C(=O)N2C(C(=O)O)CC3CCCCC32)o1 |
| InChI | InChI=1S/C16H21NO6S/c1-24(21,22)9-11-6-7-14(23-11)15(18)17-12-5-3-2-4-10(12)8-13(17)16(19)20/h6-7,10,12-13H,2-5,8-9H2,1H3,(H,19,20) |
| InChIKey | JFBDSTAZLRKCOT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |