C17H20N2O2 — CID 20895990
N-(2,5-dimethylphenyl)-2-(furan-2-yl)pyrrolidine-1-carboxamide (PubChem CID 20895990) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-(furan-2-yl)pyrrolidine-1-carboxamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-(furan-2-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 20895990 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-(furan-2-yl)pyrrolidine-1-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)N2CCCC2c2ccco2)c1 |
| InChI | InChI=1S/C17H20N2O2/c1-12-7-8-13(2)14(11-12)18-17(20)19-9-3-5-15(19)16-6-4-10-21-16/h4,6-8,10-11,15H,3,5,9H2,1-2H3,(H,18,20) |
| InChIKey | UXDUEAOKQHQRGJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |