C17H20N2O4 — CID 20895993
N-(3,4-dimethoxyphenyl)-2-(furan-2-yl)pyrrolidine-1-carboxamide (PubChem CID 20895993) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-(furan-2-yl)pyrrolidine-1-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-(furan-2-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 20895993 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-(furan-2-yl)pyrrolidine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCCC2c2ccco2)cc1OC |
| InChI | InChI=1S/C17H20N2O4/c1-21-15-8-7-12(11-16(15)22-2)18-17(20)19-9-3-5-13(19)14-6-4-10-23-14/h4,6-8,10-11,13H,3,5,9H2,1-2H3,(H,18,20) |
| InChIKey | DYQCMPXDHITNFB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |