C20H24N2O4 — CID 51856174
(2R)-N-(3,4-dimethoxyphenyl)-2-(4-methoxyphenyl)pyrrolidine-1-carboxamide (PubChem CID 51856174) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is (2R)-N-(3,4-dimethoxyphenyl)-2-(4-methoxyphenyl)pyrrolidine-1-carboxamide.
| Compound Name | (2R)-N-(3,4-dimethoxyphenyl)-2-(4-methoxyphenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 51856174 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | (2R)-N-(3,4-dimethoxyphenyl)-2-(4-methoxyphenyl)pyrrolidine-1-carboxamide |
| SMILES | COc1ccc([C@H]2CCCN2C(=O)Nc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H24N2O4/c1-24-16-9-6-14(7-10-16)17-5-4-12-22(17)20(23)21-15-8-11-18(25-2)19(13-15)26-3/h6-11,13,17H,4-5,12H2,1-3H3,(H,21,23)/t17-/m1/s1 |
| InChIKey | QAVBALTWOHIBNP-QGZVFWFLSA-N |
| XLogP | 4.08 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |